C20H24BrNOS — CID 58956366
(4aS,10bS)-5-(5-bromothiophen-2-yl)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956366) has the molecular formula C20H24BrNOS and a molecular weight of 406.39 g/mol. Its IUPAC name is (4aS,10bS)-5-(5-bromothiophen-2-yl)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,10bS)-5-(5-bromothiophen-2-yl)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956366 |
| Molecular Formula | C20H24BrNOS |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (4aS,10bS)-5-(5-bromothiophen-2-yl)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1C(c1ccc(Br)s1)N2 |
| InChI | InChI=1S/C20H24BrNOS/c1-20(2,3)12-6-7-15-14(11-12)19-13(5-4-10-23-19)18(22-15)16-8-9-17(21)24-16/h6-9,11,13,18-19,22H,4-5,10H2,1-3H3/t13-,18?,19-/m0/s1 |
| InChIKey | YAWCJUMRVDIAEM-IMWIMMFESA-N |
| XLogP | 6.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |