C22H26ClNO — CID 46881764
(4aS,10bS)-9-tert-butyl-5-(3-chlorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 46881764) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is (4aS,10bS)-9-tert-butyl-5-(3-chlorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,10bS)-9-tert-butyl-5-(3-chlorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 46881764 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (4aS,10bS)-9-tert-butyl-5-(3-chlorophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1C(c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H26ClNO/c1-22(2,3)15-9-10-19-18(13-15)21-17(8-5-11-25-21)20(24-19)14-6-4-7-16(23)12-14/h4,6-7,9-10,12-13,17,20-21,24H,5,8,11H2,1-3H3/t17-,20?,21-/m0/s1 |
| InChIKey | PXZJGWHGYKHETP-ZPWCZAOQSA-N |
| XLogP | 6.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |