C23H28N2O3 — CID 58956427
9-tert-butyl-5-(4-methyl-3-nitrophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956427) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 9-tert-butyl-5-(4-methyl-3-nitrophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 9-tert-butyl-5-(4-methyl-3-nitrophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956427 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 9-tert-butyl-5-(4-methyl-3-nitrophenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cc1ccc(C2Nc3ccc(C(C)(C)C)cc3C3OCCCC23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N2O3/c1-14-7-8-15(12-20(14)25(26)27)21-17-6-5-11-28-22(17)18-13-16(23(2,3)4)9-10-19(18)24-21/h7-10,12-13,17,21-22,24H,5-6,11H2,1-4H3 |
| InChIKey | UHGYWYDPTPEQOR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|