C19H18N2O — CID 26367385
(4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile (PubChem CID 26367385) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile.
| Compound Name | (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile |
|---|---|
| PubChem CID | 26367385 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C19H18N2O/c20-12-13-8-9-17-16(11-13)19-15(7-4-10-22-19)18(21-17)14-5-2-1-3-6-14/h1-3,5-6,8-9,11,15,18-19,21H,4,7,10H2/t15-,18-,19-/m0/s1 |
| InChIKey | QTHUJUTZPFTCCI-SNRMKQJTSA-N |
| XLogP | 4.19 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |