C20H22FNO2 — CID 98478414
(4aR,5R,10bR)-5-(2-ethoxyphenyl)-9-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 98478414) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is (4aR,5R,10bR)-5-(2-ethoxyphenyl)-9-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aR,5R,10bR)-5-(2-ethoxyphenyl)-9-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 98478414 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (4aR,5R,10bR)-5-(2-ethoxyphenyl)-9-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCOc1ccccc1[C@@H]1Nc2ccc(F)cc2[C@@H]2OCCC[C@H]12 |
| InChI | InChI=1S/C20H22FNO2/c1-2-23-18-8-4-3-6-14(18)19-15-7-5-11-24-20(15)16-12-13(21)9-10-17(16)22-19/h3-4,6,8-10,12,15,19-20,22H,2,5,7,11H2,1H3/t15-,19+,20-/m1/s1 |
| InChIKey | RLKQCEGHUWDABO-UIAACRFSSA-N |
| XLogP | 4.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |