C19H20ClNO2 — CID 92878413
(4aS,5S,10bS)-9-chloro-5-(4-methoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 92878413) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is (4aS,5S,10bS)-9-chloro-5-(4-methoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5S,10bS)-9-chloro-5-(4-methoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 92878413 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (4aS,5S,10bS)-9-chloro-5-(4-methoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | COc1ccc([C@H]2Nc3ccc(Cl)cc3[C@H]3OCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C19H20ClNO2/c1-22-14-7-4-12(5-8-14)18-15-3-2-10-23-19(15)16-11-13(20)6-9-17(16)21-18/h4-9,11,15,18-19,21H,2-3,10H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | CLYRUNAEUHOGJD-IPELMVKDSA-N |
| XLogP | 4.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |