C22H24FN — CID 126173673
(3aS,4R,9bR)-4-(4-tert-butylphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126173673) has the molecular formula C22H24FN and a molecular weight of 321.44 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(4-tert-butylphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(4-tert-butylphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126173673 |
| Molecular Formula | C22H24FN |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (3aS,4R,9bR)-4-(4-tert-butylphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CC(C)(C)c1ccc([C@@H]2Nc3ccc(F)cc3[C@@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C22H24FN/c1-22(2,3)15-9-7-14(8-10-15)21-18-6-4-5-17(18)19-13-16(23)11-12-20(19)24-21/h4-5,7-13,17-18,21,24H,6H2,1-3H3/t17-,18+,21+/m1/s1 |
| InChIKey | IMXRVLQQKVKXDZ-LQWHRVPQSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|