C26H22Cl2N2O — CID 17241381
4-(2,3-dichlorophenyl)-N-methyl-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17241381) has the molecular formula C26H22Cl2N2O and a molecular weight of 449.38 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-N-methyl-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(2,3-dichlorophenyl)-N-methyl-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17241381 |
| Molecular Formula | C26H22Cl2N2O |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-N-methyl-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1Cl)N2)c1ccccc1 |
| InChI | InChI=1S/C26H22Cl2N2O/c1-30(17-7-3-2-4-8-17)26(31)16-13-14-23-21(15-16)18-9-5-10-19(18)25(29-23)20-11-6-12-22(27)24(20)28/h2-9,11-15,18-19,25,29H,10H2,1H3 |
| InChIKey | TVABSGZAESDFQJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|