C25H30N2O2 — CID 17242789
N-[4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide (PubChem CID 17242789) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide.
| Compound Name | N-[4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 17242789 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[4-(2-ethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-methylbutanamide |
| SMILES | CCOc1ccccc1C1Nc2ccc(NC(=O)CC(C)C)cc2C2C=CCC21 |
| InChI | InChI=1S/C25H30N2O2/c1-4-29-23-11-6-5-8-20(23)25-19-10-7-9-18(19)21-15-17(12-13-22(21)27-25)26-24(28)14-16(2)3/h5-9,11-13,15-16,18-19,25,27H,4,10,14H2,1-3H3,(H,26,28) |
| InChIKey | OZWOMOXQWSNGAR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|