C30H35N3O2S — CID 17238854
4-[4-(diethylamino)phenyl]-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17238854) has the molecular formula C30H35N3O2S and a molecular weight of 501.70 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-[4-(diethylamino)phenyl]-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17238854 |
| Molecular Formula | C30H35N3O2S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCN(CC)c1ccc(C2Nc3ccc(S(=O)(=O)NCCc4ccccc4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C30H35N3O2S/c1-3-33(4-2)24-15-13-23(14-16-24)30-27-12-8-11-26(27)28-21-25(17-18-29(28)32-30)36(34,35)31-20-19-22-9-6-5-7-10-22/h5-11,13-18,21,26-27,30-32H,3-4,12,19-20H2,1-2H3 |
| InChIKey | BIBGEHWMSBBMKX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|