C28H27N3O2S — CID 17242484
4-(1H-indol-3-yl)-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17242484) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(1H-indol-3-yl)-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17242484 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-(2-phenylethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccccc1)c1ccc2c(c1)C1C=CCC1C(c1c[nH]c3ccccc13)N2 |
| InChI | InChI=1S/C28H27N3O2S/c32-34(33,30-16-15-19-7-2-1-3-8-19)20-13-14-27-24(17-20)21-10-6-11-23(21)28(31-27)25-18-29-26-12-5-4-9-22(25)26/h1-10,12-14,17-18,21,23,28-31H,11,15-16H2 |
| InChIKey | GBXIETZTYVIAIY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|