C21H19N3O — CID 17242497
4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17242497) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | 4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17242497 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C1C=CCC1C(c1c[nH]c3ccccc13)N2 |
| InChI | InChI=1S/C21H19N3O/c22-21(25)12-8-9-19-16(10-12)13-5-3-6-15(13)20(24-19)17-11-23-18-7-2-1-4-14(17)18/h1-5,7-11,13,15,20,23-24H,6H2,(H2,22,25) |
| InChIKey | AKGJUZGODHRGCG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|