C37H36N4O2S — CID 17242578
8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17242578) has the molecular formula C37H36N4O2S and a molecular weight of 600.79 g/mol. Its IUPAC name is 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17242578 |
| Molecular Formula | C37H36N4O2S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(1H-indol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1c[nH]c3ccccc13)N2)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C37H36N4O2S/c42-44(43,41-22-20-40(21-23-41)37(26-10-3-1-4-11-26)27-12-5-2-6-13-27)28-18-19-35-32(24-28)29-15-9-16-31(29)36(39-35)33-25-38-34-17-8-7-14-30(33)34/h1-15,17-19,24-25,29,31,36-39H,16,20-23H2 |
| InChIKey | FHKYZZKAQNWNLF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|