C35H33Cl2N3O2S — CID 17241322
8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17241322) has the molecular formula C35H33Cl2N3O2S and a molecular weight of 630.64 g/mol. Its IUPAC name is 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17241322 |
| Molecular Formula | C35H33Cl2N3O2S |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | 8-(4-benzhydrylpiperazin-1-yl)sulfonyl-4-(2,3-dichlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1Cl)N2)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H33Cl2N3O2S/c36-31-16-8-15-29(33(31)37)34-28-14-7-13-27(28)30-23-26(17-18-32(30)38-34)43(41,42)40-21-19-39(20-22-40)35(24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-13,15-18,23,27-28,34-35,38H,14,19-22H2 |
| InChIKey | GVPKJSMPIQJALD-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|