C23H26ClN3O2S — CID 17239376
4-(4-chlorophenyl)-8-(4-methylpiperazin-1-yl)sulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17239376) has the molecular formula C23H26ClN3O2S and a molecular weight of 444.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-8-(4-methylpiperazin-1-yl)sulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(4-chlorophenyl)-8-(4-methylpiperazin-1-yl)sulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17239376 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-(4-chlorophenyl)-8-(4-methylpiperazin-1-yl)sulfonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3c(c2)C2C=CCC2C(c2ccc(Cl)cc2)N3)CC1 |
| InChI | InChI=1S/C23H26ClN3O2S/c1-26-11-13-27(14-12-26)30(28,29)18-9-10-22-21(15-18)19-3-2-4-20(19)23(25-22)16-5-7-17(24)8-6-16/h2-3,5-10,15,19-20,23,25H,4,11-14H2,1H3 |
| InChIKey | NTFMATRYGUUETK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|