C24H25ClN2O2S — CID 17239380
4-(4-chlorophenyl)-N,N-bis(prop-2-enyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17239380) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-bis(prop-2-enyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-chlorophenyl)-N,N-bis(prop-2-enyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17239380 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-bis(prop-2-enyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-3-14-27(15-4-2)30(28,29)19-12-13-23-22(16-19)20-6-5-7-21(20)24(26-23)17-8-10-18(25)11-9-17/h3-6,8-13,16,20-21,24,26H,1-2,7,14-15H2 |
| InChIKey | NRKWHOABCWOHKA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|