C23H28N2O2S2 — CID 17244378
N,N-diethyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17244378) has the molecular formula C23H28N2O2S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N,N-diethyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N,N-diethyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17244378 |
| Molecular Formula | C23H28N2O2S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N,N-diethyl-4-(4-methylsulfanylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(SC)cc1)N2 |
| InChI | InChI=1S/C23H28N2O2S2/c1-4-25(5-2)29(26,27)18-13-14-22-21(15-18)19-7-6-8-20(19)23(24-22)16-9-11-17(28-3)12-10-16/h6-7,9-15,19-20,23-24H,4-5,8H2,1-3H3 |
| InChIKey | AOEKABFWHRKBIC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|