C30H33N3O2S — CID 17237073
N,N-diethyl-4-(9-ethylcarbazol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17237073) has the molecular formula C30H33N3O2S and a molecular weight of 499.68 g/mol. Its IUPAC name is N,N-diethyl-4-(9-ethylcarbazol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N,N-diethyl-4-(9-ethylcarbazol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17237073 |
| Molecular Formula | C30H33N3O2S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N,N-diethyl-4-(9-ethylcarbazol-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc3c(c1)c1ccccc1n3CC)N2 |
| InChI | InChI=1S/C30H33N3O2S/c1-4-32(5-2)36(34,35)21-15-16-27-25(19-21)22-11-9-12-24(22)30(31-27)20-14-17-29-26(18-20)23-10-7-8-13-28(23)33(29)6-3/h7-11,13-19,22,24,30-31H,4-6,12H2,1-3H3 |
| InChIKey | YLCXQDOPEVVCJZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|