C21H26N2O2S2 — CID 17237411
N,N-diethyl-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17237411) has the molecular formula C21H26N2O2S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is N,N-diethyl-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N,N-diethyl-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17237411 |
| Molecular Formula | C21H26N2O2S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N,N-diethyl-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1sccc1C)N2 |
| InChI | InChI=1S/C21H26N2O2S2/c1-4-23(5-2)27(24,25)15-9-10-19-18(13-15)16-7-6-8-17(16)20(22-19)21-14(3)11-12-26-21/h6-7,9-13,16-17,20,22H,4-5,8H2,1-3H3 |
| InChIKey | JYLAWZHUMLANQM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|