C25H26N2O2S2 — CID 17237414
N-(3,5-dimethylphenyl)-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17237414) has the molecular formula C25H26N2O2S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17237414 |
| Molecular Formula | C25H26N2O2S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-(3-methylthiophen-2-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc3c(c2)C2C=CCC2C(c2sccc2C)N3)c1 |
| InChI | InChI=1S/C25H26N2O2S2/c1-15-11-16(2)13-18(12-15)27-31(28,29)19-7-8-23-22(14-19)20-5-4-6-21(20)24(26-23)25-17(3)9-10-30-25/h4-5,7-14,20-21,24,26-27H,6H2,1-3H3 |
| InChIKey | OKYREGZIDHVZKP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|