C28H28N2O3S — CID 17240026
4-(4-phenylmethoxyphenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17240026) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-(4-phenylmethoxyphenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(4-phenylmethoxyphenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17240026 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 4-(4-phenylmethoxyphenyl)-N-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1ccc(OCc3ccccc3)cc1)N2 |
| InChI | InChI=1S/C28H28N2O3S/c1-2-17-29-34(31,32)23-15-16-27-26(18-23)24-9-6-10-25(24)28(30-27)21-11-13-22(14-12-21)33-19-20-7-4-3-5-8-20/h2-9,11-16,18,24-25,28-30H,1,10,17,19H2 |
| InChIKey | GRLPDGHJSWKQSU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|