C25H23ClN2O2S — CID 17238585
N-benzyl-4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17238585) has the molecular formula C25H23ClN2O2S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-benzyl-4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-benzyl-4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17238585 |
| Molecular Formula | C25H23ClN2O2S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-benzyl-4-(3-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc2c(c1)C1C=CCC1C(c1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C25H23ClN2O2S/c26-19-9-4-8-18(14-19)25-22-11-5-10-21(22)23-15-20(12-13-24(23)28-25)31(29,30)27-16-17-6-2-1-3-7-17/h1-10,12-15,21-22,25,27-28H,11,16H2 |
| InChIKey | RNNSFFWCFUPVJL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|