C25H22ClN3O4S — CID 17240474
N-benzyl-4-(2-chloro-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17240474) has the molecular formula C25H22ClN3O4S and a molecular weight of 495.99 g/mol. Its IUPAC name is N-benzyl-4-(2-chloro-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-benzyl-4-(2-chloro-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17240474 |
| Molecular Formula | C25H22ClN3O4S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-benzyl-4-(2-chloro-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C2Nc3ccc(S(=O)(=O)NCc4ccccc4)cc3C3C=CCC32)c1 |
| InChI | InChI=1S/C25H22ClN3O4S/c26-23-11-9-17(29(30)31)13-22(23)25-20-8-4-7-19(20)21-14-18(10-12-24(21)28-25)34(32,33)27-15-16-5-2-1-3-6-16/h1-7,9-14,19-20,25,27-28H,8,15H2 |
| InChIKey | HRZZHJQKVOHIRN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|