C25H23BrN2O3S — CID 17238753
N-benzyl-4-(5-bromo-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17238753) has the molecular formula C25H23BrN2O3S and a molecular weight of 511.44 g/mol. Its IUPAC name is N-benzyl-4-(5-bromo-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-benzyl-4-(5-bromo-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17238753 |
| Molecular Formula | C25H23BrN2O3S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-benzyl-4-(5-bromo-2-hydroxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc2c(c1)C1C=CCC1C(c1cc(Br)ccc1O)N2 |
| InChI | InChI=1S/C25H23BrN2O3S/c26-17-9-12-24(29)22(13-17)25-20-8-4-7-19(20)21-14-18(10-11-23(21)28-25)32(30,31)27-15-16-5-2-1-3-6-16/h1-7,9-14,19-20,25,27-29H,8,15H2 |
| InChIKey | LHWOROKDILUNCS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|