C20H21BrN2O3S — CID 17238739
4-(5-bromo-2-hydroxyphenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17238739) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 4-(5-bromo-2-hydroxyphenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | 4-(5-bromo-2-hydroxyphenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17238739 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 4-(5-bromo-2-hydroxyphenyl)-N,N-dimethyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1cc(Br)ccc1O)N2 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-23(2)27(25,26)13-7-8-18-16(11-13)14-4-3-5-15(14)20(22-18)17-10-12(21)6-9-19(17)24/h3-4,6-11,14-15,20,22,24H,5H2,1-2H3 |
| InChIKey | GVDHMLUQYWVWLX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|