C26H25N3O5S — CID 17240908
N-ethyl-4-(2-hydroxy-5-nitrophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 17240908) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxy-5-nitrophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | N-ethyl-4-(2-hydroxy-5-nitrophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 17240908 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-ethyl-4-(2-hydroxy-5-nitrophenyl)-N-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)C1C=CCC1C(c1cc([N+](=O)[O-])ccc1O)N2 |
| InChI | InChI=1S/C26H25N3O5S/c1-2-28(17-7-4-3-5-8-17)35(33,34)19-12-13-24-22(16-19)20-9-6-10-21(20)26(27-24)23-15-18(29(31)32)11-14-25(23)30/h3-9,11-16,20-21,26-27,30H,2,10H2,1H3 |
| InChIKey | FKVSKLCKKGYYTO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|