C27H25N3O4 — CID 17241066
N-[4-(2-hydroxy-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-phenylpropanamide (PubChem CID 17241066) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[4-(2-hydroxy-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-phenylpropanamide.
| Compound Name | N-[4-(2-hydroxy-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 17241066 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[4-(2-hydroxy-5-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc2c(c1)C1C=CCC1C(c1cc([N+](=O)[O-])ccc1O)N2 |
| InChI | InChI=1S/C27H25N3O4/c31-25-13-11-19(30(33)34)16-23(25)27-21-8-4-7-20(21)22-15-18(10-12-24(22)29-27)28-26(32)14-9-17-5-2-1-3-6-17/h1-7,10-13,15-16,20-21,27,29,31H,8-9,14H2,(H,28,32) |
| InChIKey | FCFUTQNDFQAKSV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|