C21H25N3 — CID 17243136
N,N-diethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine (PubChem CID 17243136) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is N,N-diethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine.
| Compound Name | N,N-diethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine |
|---|---|
| PubChem CID | 17243136 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N,N-diethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-amine |
| SMILES | CCN(CC)c1ccc2c(c1)C1C=CCC1C(c1cccnc1)N2 |
| InChI | InChI=1S/C21H25N3/c1-3-24(4-2)16-10-11-20-19(13-16)17-8-5-9-18(17)21(23-20)15-7-6-12-22-14-15/h5-8,10-14,17-18,21,23H,3-4,9H2,1-2H3 |
| InChIKey | GHESVDCHQFWHAM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|