C20H21N3O — CID 17243270
N,N-dimethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 17243270) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N,N-dimethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | N,N-dimethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 17243270 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N,N-dimethyl-4-pyridin-3-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)C1C=CCC1C(c1cccnc1)N2 |
| InChI | InChI=1S/C20H21N3O/c1-23(2)20(24)13-8-9-18-17(11-13)15-6-3-7-16(15)19(22-18)14-5-4-10-21-12-14/h3-6,8-12,15-16,19,22H,7H2,1-2H3 |
| InChIKey | URYLJIBZVYNTOO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|