C26H24N4O — CID 7410473
N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 7410473) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7410473 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cccnc1)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C26H24N4O/c1-17(29-30-26(31)20-9-6-14-27-16-20)19-12-13-24-23(15-19)21-10-5-11-22(21)25(28-24)18-7-3-2-4-8-18/h2-10,12-16,21-22,25,28H,11H2,1H3,(H,30,31)/b29-17-/t21-,22+,25+/m1/s1 |
| InChIKey | SJSDAHHZYJBBPN-FKYCONGHSA-N |
| XLogP | 5.06 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|