C31H27N3O2 — CID 40905961
N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 40905961) has the molecular formula C31H27N3O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 40905961 |
| Molecular Formula | C31H27N3O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc2ccccc2cc1O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C31H27N3O2/c1-19(33-34-31(36)27-17-22-10-5-6-11-23(22)18-29(27)35)21-14-15-28-26(16-21)24-12-7-13-25(24)30(32-28)20-8-3-2-4-9-20/h2-12,14-18,24-25,30,32,35H,13H2,1H3,(H,34,36)/b33-19-/t24-,25+,30+/m1/s1 |
| InChIKey | TVKWLAPEUOAAHY-XDCSVYQZSA-N |
| XLogP | 6.53 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|