C29H28ClN3OS — CID 53278861
N-[(E)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 53278861) has the molecular formula C29H28ClN3OS and a molecular weight of 502.08 g/mol. Its IUPAC name is N-[(E)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | N-[(E)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 53278861 |
| Molecular Formula | C29H28ClN3OS |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N-[(E)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | C/C(=N\NC(=O)C(C)Sc1ccccc1)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1Cl)N2 |
| InChI | InChI=1S/C29H28ClN3OS/c1-18(32-33-29(34)19(2)35-21-9-4-3-5-10-21)20-15-16-27-25(17-20)22-12-8-13-23(22)28(31-27)24-11-6-7-14-26(24)30/h3-12,14-17,19,22-23,28,31H,13H2,1-2H3,(H,33,34)/b32-18+/t19?,22-,23+,28-/m1/s1 |
| InChIKey | GYMBMQSAEYUVIX-NYEYXXHISA-N |
| XLogP | 7.19 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|