C31H31N3O3S — CID 124539809
methyl 4-[(3aS,4R,9bR)-8-[(Z)-C-methyl-N-[[(2R)-2-phenylsulfanylpropanoyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 124539809) has the molecular formula C31H31N3O3S and a molecular weight of 525.67 g/mol. Its IUPAC name is methyl 4-[(3aS,4R,9bR)-8-[(Z)-C-methyl-N-[[(2R)-2-phenylsulfanylpropanoyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(3aS,4R,9bR)-8-[(Z)-C-methyl-N-[[(2R)-2-phenylsulfanylpropanoyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 124539809 |
| Molecular Formula | C31H31N3O3S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | methyl 4-[(3aS,4R,9bR)-8-[(Z)-C-methyl-N-[[(2R)-2-phenylsulfanylpropanoyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(/C(C)=N\NC(=O)[C@@H](C)Sc4ccccc4)cc3[C@@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C31H31N3O3S/c1-19(33-34-30(35)20(2)38-24-8-5-4-6-9-24)23-16-17-28-27(18-23)25-10-7-11-26(25)29(32-28)21-12-14-22(15-13-21)31(36)37-3/h4-10,12-18,20,25-26,29,32H,11H2,1-3H3,(H,34,35)/b33-19-/t20-,25-,26+,29+/m1/s1 |
| InChIKey | ZRDILTLNSISLSG-ZYTMRPSKSA-N |
| XLogP | 6.32 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|