C29H27N3O4 — CID 40905960
methyl 4-[(3aR,4R,9bS)-8-[(Z)-N-[(2-hydroxybenzoyl)amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 40905960) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 4-[(3aR,4R,9bS)-8-[(Z)-N-[(2-hydroxybenzoyl)amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(3aR,4R,9bS)-8-[(Z)-N-[(2-hydroxybenzoyl)amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 40905960 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | methyl 4-[(3aR,4R,9bS)-8-[(Z)-N-[(2-hydroxybenzoyl)amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(/C(C)=N\NC(=O)c4ccccc4O)cc3[C@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C29H27N3O4/c1-17(31-32-28(34)23-6-3-4-9-26(23)33)20-14-15-25-24(16-20)21-7-5-8-22(21)27(30-25)18-10-12-19(13-11-18)29(35)36-2/h3-7,9-16,21-22,27,30,33H,8H2,1-2H3,(H,32,34)/b31-17-/t21-,22+,27-/m0/s1 |
| InChIKey | IKEZOTBPZRETAX-TZHPNRCJSA-N |
| XLogP | 5.16 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|