C31H30ClN3O3S — CID 124539785
methyl 4-[(3aS,4R,9bR)-8-[(Z)-N-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 124539785) has the molecular formula C31H30ClN3O3S and a molecular weight of 560.12 g/mol. Its IUPAC name is methyl 4-[(3aS,4R,9bR)-8-[(Z)-N-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(3aS,4R,9bR)-8-[(Z)-N-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 124539785 |
| Molecular Formula | C31H30ClN3O3S |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | methyl 4-[(3aS,4R,9bR)-8-[(Z)-N-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(/C(C)=N\NC(=O)CSCc4ccccc4Cl)cc3[C@@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C31H30ClN3O3S/c1-19(34-35-29(36)18-39-17-23-6-3-4-9-27(23)32)22-14-15-28-26(16-22)24-7-5-8-25(24)30(33-28)20-10-12-21(13-11-20)31(37)38-2/h3-7,9-16,24-25,30,33H,8,17-18H2,1-2H3,(H,35,36)/b34-19-/t24-,25+,30+/m1/s1 |
| InChIKey | NBYGNTXLFFXZFL-VMZMSZQESA-N |
| XLogP | 6.73 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|