C28H24Cl3N3O2 — CID 124539805
N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 124539805) has the molecular formula C28H24Cl3N3O2 and a molecular weight of 540.88 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 124539805 |
| Molecular Formula | C28H24Cl3N3O2 |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | C/C(=N/NC(=O)COc1ccc(Cl)cc1Cl)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1Cl)N2 |
| InChI | InChI=1S/C28H24Cl3N3O2/c1-16(33-34-27(35)15-36-26-12-10-18(29)14-24(26)31)17-9-11-25-22(13-17)19-6-4-7-20(19)28(32-25)21-5-2-3-8-23(21)30/h2-6,8-14,19-20,28,32H,7,15H2,1H3,(H,34,35)/b33-16-/t19-,20+,28-/m1/s1 |
| InChIKey | ATHBKLFMIXJHQW-DOVAMCHSSA-N |
| XLogP | 7.39 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|