C32H35N3O4S — CID 124539928
N-[(Z)-1-[(3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide (PubChem CID 124539928) has the molecular formula C32H35N3O4S and a molecular weight of 557.72 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 124539928 |
| Molecular Formula | C32H35N3O4S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2,3-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)N/N=C(/C)c2ccc3c(c2)[C@@H]2C=CC[C@@H]2[C@H](c2cccc(OC)c2OC)N3)cc1 |
| InChI | InChI=1S/C32H35N3O4S/c1-20(34-35-30(36)19-40-18-21-11-14-23(37-2)15-12-21)22-13-16-28-27(17-22)24-7-5-8-25(24)31(33-28)26-9-6-10-29(38-3)32(26)39-4/h5-7,9-17,24-25,31,33H,8,18-19H2,1-4H3,(H,35,36)/b34-20-/t24-,25+,31-/m1/s1 |
| InChIKey | QYRRJXHOBJQUTB-FKLGDXBMSA-N |
| XLogP | 6.31 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|