C32H33ClN4O2 — CID 124539821
N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 124539821) has the molecular formula C32H33ClN4O2 and a molecular weight of 541.10 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 124539821 |
| Molecular Formula | C32H33ClN4O2 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-(2-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CN2CCOCC2)cc1)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1Cl)N2 |
| InChI | InChI=1S/C32H33ClN4O2/c1-21(35-36-32(38)23-11-9-22(10-12-23)20-37-15-17-39-18-16-37)24-13-14-30-28(19-24)25-6-4-7-26(25)31(34-30)27-5-2-3-8-29(27)33/h2-6,8-14,19,25-26,31,34H,7,15-18,20H2,1H3,(H,36,38)/b35-21-/t25-,26+,31-/m1/s1 |
| InChIKey | DCUNTJAFHLWMEA-HMDNGGLLSA-N |
| XLogP | 6.15 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|