C37H36N4O — CID 124539823
N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide (PubChem CID 124539823) has the molecular formula C37H36N4O and a molecular weight of 552.72 g/mol. Its IUPAC name is N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide.
| Compound Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 124539823 |
| Molecular Formula | C37H36N4O |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | N-[(Z)-1-[(3aS,4R,9bR)-4-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethylideneamino]-4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CN2CCc3ccccc3C2)cc1)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C37H36N4O/c1-25(30-18-19-35-34(22-30)32-12-7-13-33(32)36(38-35)28-9-3-2-4-10-28)39-40-37(42)29-16-14-26(15-17-29)23-41-21-20-27-8-5-6-11-31(27)24-41/h2-12,14-19,22,32-33,36,38H,13,20-21,23-24H2,1H3,(H,40,42)/b39-25-/t32-,33+,36+/m1/s1 |
| InChIKey | MWEXNKGSIVYRCJ-WSTUJXLBSA-N |
| XLogP | 7.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|