C28H31N3O5 — CID 40830519
methyl 4-[(3aR,4R,9bR)-8-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 40830519) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is methyl 4-[(3aR,4R,9bR)-8-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(3aR,4R,9bR)-8-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 40830519 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | methyl 4-[(3aR,4R,9bR)-8-[(Z)-C-methyl-N-[[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]amino]carbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(/C(C)=N\NC(=O)CC4(C)OCCO4)cc3[C@@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C28H31N3O5/c1-17(30-31-25(32)16-28(2)35-13-14-36-28)20-11-12-24-23(15-20)21-5-4-6-22(21)26(29-24)18-7-9-19(10-8-18)27(33)34-3/h4-5,7-12,15,21-22,26,29H,6,13-14,16H2,1-3H3,(H,31,32)/b30-17-/t21-,22-,26+/m1/s1 |
| InChIKey | KCHMRVKCPNKWDT-NSSZUCMWSA-N |
| XLogP | 4.29 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|