C37H36N4O6S — CID 6804390
methyl 4-[8-[N-[[2-(N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 6804390) has the molecular formula C37H36N4O6S and a molecular weight of 664.78 g/mol. Its IUPAC name is methyl 4-[8-[N-[[2-(N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[8-[N-[[2-(N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 6804390 |
| Molecular Formula | C37H36N4O6S |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | methyl 4-[8-[N-[[2-(N-(4-methoxyphenyl)sulfonylanilino)acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3ccc(C(C)=NNC(=O)CN(c4ccccc4)S(=O)(=O)c4ccc(OC)cc4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C37H36N4O6S/c1-24(39-40-35(42)23-41(28-8-5-4-6-9-28)48(44,45)30-19-17-29(46-2)18-20-30)27-16-21-34-33(22-27)31-10-7-11-32(31)36(38-34)25-12-14-26(15-13-25)37(43)47-3/h4-10,12-22,31-32,36,38H,11,23H2,1-3H3,(H,40,42) |
| InChIKey | AXCDWNRASRWCQJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|