C36H33N5O7S — CID 6810674
methyl 4-[8-[N-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate (PubChem CID 6810674) has the molecular formula C36H33N5O7S and a molecular weight of 679.76 g/mol. Its IUPAC name is methyl 4-[8-[N-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[8-[N-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 6810674 |
| Molecular Formula | C36H33N5O7S |
| Molecular Weight | 679.76 g/mol |
| Exact Mass | 679.21 |
| IUPAC Name | methyl 4-[8-[N-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-C-methylcarbonimidoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3ccc(C(C)=NNC(=O)CN(c4cccc([N+](=O)[O-])c4)S(=O)(=O)c4ccccc4)cc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C36H33N5O7S/c1-23(38-39-34(42)22-40(27-8-6-9-28(21-27)41(44)45)49(46,47)29-10-4-3-5-11-29)26-18-19-33-32(20-26)30-12-7-13-31(30)35(37-33)24-14-16-25(17-15-24)36(43)48-2/h3-12,14-21,30-31,35,37H,13,22H2,1-2H3,(H,39,42) |
| InChIKey | SKHFGGLUJKSTAS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.76 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|