C23H28N2O2 — CID 17237706
5-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-2-methoxyphenol (PubChem CID 17237706) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-2-methoxyphenol.
| Compound Name | 5-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 17237706 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 5-[8-(diethylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-2-methoxyphenol |
| SMILES | CCN(CC)c1ccc2c(c1)C1C=CCC1C(c1ccc(OC)c(O)c1)N2 |
| InChI | InChI=1S/C23H28N2O2/c1-4-25(5-2)16-10-11-20-19(14-16)17-7-6-8-18(17)23(24-20)15-9-12-22(27-3)21(26)13-15/h6-7,9-14,17-18,23-24,26H,4-5,8H2,1-3H3 |
| InChIKey | WMLYBAAKIHOQHW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|