C19H18INO2 — CID 17237717
5-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenol (PubChem CID 17237717) has the molecular formula C19H18INO2 and a molecular weight of 419.26 g/mol. Its IUPAC name is 5-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenol.
| Compound Name | 5-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenol |
|---|---|
| PubChem CID | 17237717 |
| Molecular Formula | C19H18INO2 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 5-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)-2-methoxyphenol |
| SMILES | COc1ccc(C2Nc3ccc(I)cc3C3C=CCC32)cc1O |
| InChI | InChI=1S/C19H18INO2/c1-23-18-8-5-11(9-17(18)22)19-14-4-2-3-13(14)15-10-12(20)6-7-16(15)21-19/h2-3,5-10,13-14,19,21-22H,4H2,1H3 |
| InChIKey | BZABXAASPXVYCE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|