C19H18INO — CID 11904121
(3aS,4R,9bS)-8-iodo-4-(2-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 11904121) has the molecular formula C19H18INO and a molecular weight of 403.26 g/mol. Its IUPAC name is (3aS,4R,9bS)-8-iodo-4-(2-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-8-iodo-4-(2-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 11904121 |
| Molecular Formula | C19H18INO |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (3aS,4R,9bS)-8-iodo-4-(2-methoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1ccccc1[C@@H]1Nc2ccc(I)cc2[C@H]2C=CC[C@@H]21 |
| InChI | InChI=1S/C19H18INO/c1-22-18-8-3-2-5-15(18)19-14-7-4-6-13(14)16-11-12(20)9-10-17(16)21-19/h2-6,8-11,13-14,19,21H,7H2,1H3/t13-,14-,19+/m0/s1 |
| InChIKey | NUAVAFAHUHNVNE-CKFHNAJUSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|