C20H20INO2 — CID 124678052
(3aS,4R,9bR)-4-(3,4-dimethoxyphenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 124678052) has the molecular formula C20H20INO2 and a molecular weight of 433.29 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3,4-dimethoxyphenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3,4-dimethoxyphenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 124678052 |
| Molecular Formula | C20H20INO2 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (3aS,4R,9bR)-4-(3,4-dimethoxyphenyl)-8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1ccc([C@@H]2Nc3ccc(I)cc3[C@@H]3C=CC[C@@H]32)cc1OC |
| InChI | InChI=1S/C20H20INO2/c1-23-18-9-6-12(10-19(18)24-2)20-15-5-3-4-14(15)16-11-13(21)7-8-17(16)22-20/h3-4,6-11,14-15,20,22H,5H2,1-2H3/t14-,15+,20+/m1/s1 |
| InChIKey | RJWSLZOBEJBVOF-SIFCLUCFSA-N |
| XLogP | 5.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|