C21H22BrNO3 — CID 17236876
8-bromo-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17236876) has the molecular formula C21H22BrNO3 and a molecular weight of 416.32 g/mol. Its IUPAC name is 8-bromo-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 8-bromo-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17236876 |
| Molecular Formula | C21H22BrNO3 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 8-bromo-4-(3,4,5-trimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc(C2Nc3ccc(Br)cc3C3C=CCC32)cc(OC)c1OC |
| InChI | InChI=1S/C21H22BrNO3/c1-24-18-9-12(10-19(25-2)21(18)26-3)20-15-6-4-5-14(15)16-11-13(22)7-8-17(16)23-20/h4-5,7-11,14-15,20,23H,6H2,1-3H3 |
| InChIKey | OWFLNCQFUNDERZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|