C26H24BrNO2 — CID 126175166
(3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126175166) has the molecular formula C26H24BrNO2 and a molecular weight of 462.39 g/mol. Its IUPAC name is (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126175166 |
| Molecular Formula | C26H24BrNO2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (3aR,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-8-phenyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3ccc(-c4ccccc4)cc3[C@@H]3C=CC[C@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C26H24BrNO2/c1-29-24-15-18(14-22(27)26(24)30-2)25-20-10-6-9-19(20)21-13-17(11-12-23(21)28-25)16-7-4-3-5-8-16/h3-9,11-15,19-20,25,28H,10H2,1-2H3/t19-,20-,25+/m1/s1 |
| InChIKey | OFIOFGCKDFEYTD-FHAGJXEFSA-N |
| XLogP | 6.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|