C20H18BrCl2NO2 — CID 126191866
(3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126191866) has the molecular formula C20H18BrCl2NO2 and a molecular weight of 455.18 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126191866 |
| Molecular Formula | C20H18BrCl2NO2 |
| Molecular Weight | 455.18 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6,9-dichloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)ccc(Cl)c3[C@@H]3C=CC[C@@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C20H18BrCl2NO2/c1-25-16-9-10(8-13(21)20(16)26-2)18-12-5-3-4-11(12)17-14(22)6-7-15(23)19(17)24-18/h3-4,6-9,11-12,18,24H,5H2,1-2H3/t11-,12+,18+/m1/s1 |
| InChIKey | NKBORLCMCSBUKS-SOZUMNATSA-N |
| XLogP | 6.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.18 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|