C20H18BrClN2O4 — CID 126179995
(3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126179995) has the molecular formula C20H18BrClN2O4 and a molecular weight of 465.73 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126179995 |
| Molecular Formula | C20H18BrClN2O4 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | (3aS,4R,9bR)-4-(3-bromo-4,5-dimethoxyphenyl)-6-chloro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([C@@H]2Nc3c(Cl)ccc([N+](=O)[O-])c3[C@@H]3C=CC[C@@H]32)cc(Br)c1OC |
| InChI | InChI=1S/C20H18BrClN2O4/c1-27-16-9-10(8-13(21)20(16)28-2)18-12-5-3-4-11(12)17-15(24(25)26)7-6-14(22)19(17)23-18/h3-4,6-9,11-12,18,23H,5H2,1-2H3/t11-,12+,18+/m1/s1 |
| InChIKey | QPPBVVINAYHVHS-SOZUMNATSA-N |
| XLogP | 5.85 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|